C16H13N5O — CID 141430956
2-amino-5-[(6-methoxyquinazolin-2-yl)amino]benzonitrile (PubChem CID 141430956) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-amino-5-[(6-methoxyquinazolin-2-yl)amino]benzonitrile.
| Compound Name | 2-amino-5-[(6-methoxyquinazolin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 141430956 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-amino-5-[(6-methoxyquinazolin-2-yl)amino]benzonitrile |
| SMILES | COc1ccc2nc(Nc3ccc(N)c(C#N)c3)ncc2c1 |
| InChI | InChI=1S/C16H13N5O/c1-22-13-3-5-15-11(7-13)9-19-16(21-15)20-12-2-4-14(18)10(6-12)8-17/h2-7,9H,18H2,1H3,(H,19,20,21) |
| InChIKey | JPJYLUJOKKPHMG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|