C22H23N7O2 — CID 118977027
N-[1-[2-(4-amino-3-cyanoanilino)-7-methoxyquinazolin-4-yl]pyrrolidin-3-yl]acetamide (PubChem CID 118977027) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[1-[2-(4-amino-3-cyanoanilino)-7-methoxyquinazolin-4-yl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-[2-(4-amino-3-cyanoanilino)-7-methoxyquinazolin-4-yl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 118977027 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[1-[2-(4-amino-3-cyanoanilino)-7-methoxyquinazolin-4-yl]pyrrolidin-3-yl]acetamide |
| SMILES | COc1ccc2c(N3CCC(NC(C)=O)C3)nc(Nc3ccc(N)c(C#N)c3)nc2c1 |
| InChI | InChI=1S/C22H23N7O2/c1-13(30)25-16-7-8-29(12-16)21-18-5-4-17(31-2)10-20(18)27-22(28-21)26-15-3-6-19(24)14(9-15)11-23/h3-6,9-10,16H,7-8,12,24H2,1-2H3,(H,25,30)(H,26,27,28) |
| InChIKey | YJMQVWOXPIMSNP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|