C20H26ClN7O3 — CID 118976895
N-[(3S)-1-[2-(4-amino-3-nitroanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]pyrrolidin-3-yl]acetamide;hydrochloride (PubChem CID 118976895) has the molecular formula C20H26ClN7O3 and a molecular weight of 447.93 g/mol. Its IUPAC name is N-[(3S)-1-[2-(4-amino-3-nitroanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]pyrrolidin-3-yl]acetamide;hydrochloride.
| Compound Name | N-[(3S)-1-[2-(4-amino-3-nitroanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]pyrrolidin-3-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 118976895 |
| Molecular Formula | C20H26ClN7O3 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[(3S)-1-[2-(4-amino-3-nitroanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]pyrrolidin-3-yl]acetamide;hydrochloride |
| SMILES | CC(=O)N[C@H]1CCN(c2nc(Nc3ccc(N)c([N+](=O)[O-])c3)nc3c2CCCC3)C1.Cl |
| InChI | InChI=1S/C20H25N7O3.ClH/c1-12(28)22-14-8-9-26(11-14)19-15-4-2-3-5-17(15)24-20(25-19)23-13-6-7-16(21)18(10-13)27(29)30;/h6-7,10,14H,2-5,8-9,11,21H2,1H3,(H,22,28)(H,23,24,25);1H/t14-;/m0./s1 |
| InChIKey | KZXMJRWUQUPOPP-UQKRIMTDSA-N |
| XLogP | 2.73 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|