C19H25N7O2 — CID 118977424
4-N-[4-[(3R)-3-(methylamino)piperidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-2-nitrobenzene-1,4-diamine (PubChem CID 118977424) has the molecular formula C19H25N7O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 4-N-[4-[(3R)-3-(methylamino)piperidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-2-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[4-[(3R)-3-(methylamino)piperidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-2-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 118977424 |
| Molecular Formula | C19H25N7O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 4-N-[4-[(3R)-3-(methylamino)piperidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]-2-nitrobenzene-1,4-diamine |
| SMILES | CN[C@@H]1CCCN(c2nc(Nc3ccc(N)c([N+](=O)[O-])c3)nc3c2CCC3)C1 |
| InChI | InChI=1S/C19H25N7O2/c1-21-13-4-3-9-25(11-13)18-14-5-2-6-16(14)23-19(24-18)22-12-7-8-15(20)17(10-12)26(27)28/h7-8,10,13,21H,2-6,9,11,20H2,1H3,(H,22,23,24)/t13-/m1/s1 |
| InChIKey | HBEDCPHSSAWNCL-CYBMUJFWSA-N |
| XLogP | 2.39 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|