C19H29Cl2N7O2 — CID 140625435
4-N-[4-[3-(methylamino)piperidin-1-yl]-6-propylpyrimidin-2-yl]-2-nitrobenzene-1,4-diamine;dihydrochloride (PubChem CID 140625435) has the molecular formula C19H29Cl2N7O2 and a molecular weight of 458.39 g/mol. Its IUPAC name is 4-N-[4-[3-(methylamino)piperidin-1-yl]-6-propylpyrimidin-2-yl]-2-nitrobenzene-1,4-diamine;dihydrochloride.
| Compound Name | 4-N-[4-[3-(methylamino)piperidin-1-yl]-6-propylpyrimidin-2-yl]-2-nitrobenzene-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 140625435 |
| Molecular Formula | C19H29Cl2N7O2 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-N-[4-[3-(methylamino)piperidin-1-yl]-6-propylpyrimidin-2-yl]-2-nitrobenzene-1,4-diamine;dihydrochloride |
| SMILES | CCCc1cc(N2CCCC(NC)C2)nc(Nc2ccc(N)c([N+](=O)[O-])c2)n1.Cl.Cl |
| InChI | InChI=1S/C19H27N7O2.2ClH/c1-3-5-13-11-18(25-9-4-6-15(12-25)21-2)24-19(22-13)23-14-7-8-16(20)17(10-14)26(27)28;;/h7-8,10-11,15,21H,3-6,9,12,20H2,1-2H3,(H,22,23,24);2*1H |
| InChIKey | ITTALQFBEQIXFK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|