C20H30Cl2N6O2 — CID 121332158
4-butyl-6-[(3S)-3-(methylamino)pyrrolidin-1-yl]-N-(4-methyl-3-nitrophenyl)pyrimidin-2-amine;dihydrochloride (PubChem CID 121332158) has the molecular formula C20H30Cl2N6O2 and a molecular weight of 457.41 g/mol. Its IUPAC name is 4-butyl-6-[(3S)-3-(methylamino)pyrrolidin-1-yl]-N-(4-methyl-3-nitrophenyl)pyrimidin-2-amine;dihydrochloride.
| Compound Name | 4-butyl-6-[(3S)-3-(methylamino)pyrrolidin-1-yl]-N-(4-methyl-3-nitrophenyl)pyrimidin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 121332158 |
| Molecular Formula | C20H30Cl2N6O2 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-butyl-6-[(3S)-3-(methylamino)pyrrolidin-1-yl]-N-(4-methyl-3-nitrophenyl)pyrimidin-2-amine;dihydrochloride |
| SMILES | CCCCc1cc(N2CC[C@H](NC)C2)nc(Nc2ccc(C)c([N+](=O)[O-])c2)n1.Cl.Cl |
| InChI | InChI=1S/C20H28N6O2.2ClH/c1-4-5-6-15-12-19(25-10-9-17(13-25)21-3)24-20(22-15)23-16-8-7-14(2)18(11-16)26(27)28;;/h7-8,11-12,17,21H,4-6,9-10,13H2,1-3H3,(H,22,23,24);2*1H/t17-;;/m0../s1 |
| InChIKey | DBPGJACTVBVWMJ-RMRYJAPISA-N |
| XLogP | 4.42 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|