C20H29Cl2FN6O2 — CID 121332076
4-butyl-6-[3-(ethylamino)pyrrolidin-1-yl]-N-(4-fluoro-3-nitrophenyl)pyrimidin-2-amine;dihydrochloride (PubChem CID 121332076) has the molecular formula C20H29Cl2FN6O2 and a molecular weight of 475.40 g/mol. Its IUPAC name is 4-butyl-6-[3-(ethylamino)pyrrolidin-1-yl]-N-(4-fluoro-3-nitrophenyl)pyrimidin-2-amine;dihydrochloride.
| Compound Name | 4-butyl-6-[3-(ethylamino)pyrrolidin-1-yl]-N-(4-fluoro-3-nitrophenyl)pyrimidin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 121332076 |
| Molecular Formula | C20H29Cl2FN6O2 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 4-butyl-6-[3-(ethylamino)pyrrolidin-1-yl]-N-(4-fluoro-3-nitrophenyl)pyrimidin-2-amine;dihydrochloride |
| SMILES | CCCCc1cc(N2CCC(NCC)C2)nc(Nc2ccc(F)c([N+](=O)[O-])c2)n1.Cl.Cl |
| InChI | InChI=1S/C20H27FN6O2.2ClH/c1-3-5-6-14-12-19(26-10-9-16(13-26)22-4-2)25-20(23-14)24-15-7-8-17(21)18(11-15)27(28)29;;/h7-8,11-12,16,22H,3-6,9-10,13H2,1-2H3,(H,23,24,25);2*1H |
| InChIKey | SZZNEBXMLMSOAV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|