C21H29F3N6 — CID 140626276
3-N-[4-butyl-6-[3-(ethylamino)pyrrolidin-1-yl]pyrimidin-2-yl]-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 140626276) has the molecular formula C21H29F3N6 and a molecular weight of 422.50 g/mol. Its IUPAC name is 3-N-[4-butyl-6-[3-(ethylamino)pyrrolidin-1-yl]pyrimidin-2-yl]-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N-[4-butyl-6-[3-(ethylamino)pyrrolidin-1-yl]pyrimidin-2-yl]-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 140626276 |
| Molecular Formula | C21H29F3N6 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-N-[4-butyl-6-[3-(ethylamino)pyrrolidin-1-yl]pyrimidin-2-yl]-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | CCCCc1cc(N2CCC(NCC)C2)nc(Nc2cc(N)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H29F3N6/c1-3-5-6-16-12-19(30-8-7-17(13-30)26-4-2)29-20(27-16)28-18-10-14(21(22,23)24)9-15(25)11-18/h9-12,17,26H,3-8,13,25H2,1-2H3,(H,27,28,29) |
| InChIKey | HACDNRNYWKZQTH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|