C20H27F3N6 — CID 72673626
3-N-[4-(3-aminopiperidin-1-yl)-6-butylpyrimidin-2-yl]-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 72673626) has the molecular formula C20H27F3N6 and a molecular weight of 408.47 g/mol. Its IUPAC name is 3-N-[4-(3-aminopiperidin-1-yl)-6-butylpyrimidin-2-yl]-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N-[4-(3-aminopiperidin-1-yl)-6-butylpyrimidin-2-yl]-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 72673626 |
| Molecular Formula | C20H27F3N6 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-N-[4-(3-aminopiperidin-1-yl)-6-butylpyrimidin-2-yl]-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | CCCCc1cc(N2CCCC(N)C2)nc(Nc2cc(N)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H27F3N6/c1-2-3-6-16-11-18(29-7-4-5-14(24)12-29)28-19(26-16)27-17-9-13(20(21,22)23)8-15(25)10-17/h8-11,14H,2-7,12,24-25H2,1H3,(H,26,27,28) |
| InChIKey | MXQATHQSZXKUKP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|