C20H29Cl2N7 — CID 121292856
3-amino-5-[[4-(3-aminopiperidin-1-yl)-6-butylpyrimidin-2-yl]amino]benzonitrile;dihydrochloride (PubChem CID 121292856) has the molecular formula C20H29Cl2N7 and a molecular weight of 438.41 g/mol. Its IUPAC name is 3-amino-5-[[4-(3-aminopiperidin-1-yl)-6-butylpyrimidin-2-yl]amino]benzonitrile;dihydrochloride.
| Compound Name | 3-amino-5-[[4-(3-aminopiperidin-1-yl)-6-butylpyrimidin-2-yl]amino]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 121292856 |
| Molecular Formula | C20H29Cl2N7 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 3-amino-5-[[4-(3-aminopiperidin-1-yl)-6-butylpyrimidin-2-yl]amino]benzonitrile;dihydrochloride |
| SMILES | CCCCc1cc(N2CCCC(N)C2)nc(Nc2cc(N)cc(C#N)c2)n1.Cl.Cl |
| InChI | InChI=1S/C20H27N7.2ClH/c1-2-3-6-17-11-19(27-7-4-5-15(22)13-27)26-20(24-17)25-18-9-14(12-21)8-16(23)10-18;;/h8-11,15H,2-7,13,22-23H2,1H3,(H,24,25,26);2*1H |
| InChIKey | LCZUEAFDGJUEDR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|