C21H32N6 — CID 121292661
1-N-[4-butyl-6-[(3R)-3-(methylamino)piperidin-1-yl]pyrimidin-2-yl]-4-methylbenzene-1,3-diamine (PubChem CID 121292661) has the molecular formula C21H32N6 and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-N-[4-butyl-6-[(3R)-3-(methylamino)piperidin-1-yl]pyrimidin-2-yl]-4-methylbenzene-1,3-diamine.
| Compound Name | 1-N-[4-butyl-6-[(3R)-3-(methylamino)piperidin-1-yl]pyrimidin-2-yl]-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 121292661 |
| Molecular Formula | C21H32N6 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 1-N-[4-butyl-6-[(3R)-3-(methylamino)piperidin-1-yl]pyrimidin-2-yl]-4-methylbenzene-1,3-diamine |
| SMILES | CCCCc1cc(N2CCC[C@@H](NC)C2)nc(Nc2ccc(C)c(N)c2)n1 |
| InChI | InChI=1S/C21H32N6/c1-4-5-7-16-13-20(27-11-6-8-18(14-27)23-3)26-21(24-16)25-17-10-9-15(2)19(22)12-17/h9-10,12-13,18,23H,4-8,11,14,22H2,1-3H3,(H,24,25,26)/t18-/m1/s1 |
| InChIKey | ZONYRFJPQVWYJC-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|