C19H27N5 — CID 77463321
4-methyl-1-N-[4-(2-methylpyrrolidin-1-yl)-6-propylpyrimidin-2-yl]benzene-1,3-diamine (PubChem CID 77463321) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is 4-methyl-1-N-[4-(2-methylpyrrolidin-1-yl)-6-propylpyrimidin-2-yl]benzene-1,3-diamine.
| Compound Name | 4-methyl-1-N-[4-(2-methylpyrrolidin-1-yl)-6-propylpyrimidin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 77463321 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 4-methyl-1-N-[4-(2-methylpyrrolidin-1-yl)-6-propylpyrimidin-2-yl]benzene-1,3-diamine |
| SMILES | CCCc1cc(N2CCCC2C)nc(Nc2ccc(C)c(N)c2)n1 |
| InChI | InChI=1S/C19H27N5/c1-4-6-15-12-18(24-10-5-7-14(24)3)23-19(21-15)22-16-9-8-13(2)17(20)11-16/h8-9,11-12,14H,4-7,10,20H2,1-3H3,(H,21,22,23) |
| InChIKey | RLSZNZSQFPLDKG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|