C18H25N7O2 — CID 134324541
4-N-[4-(2-methylpiperazin-1-yl)-6-propylpyrimidin-2-yl]-2-nitrobenzene-1,4-diamine (PubChem CID 134324541) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is 4-N-[4-(2-methylpiperazin-1-yl)-6-propylpyrimidin-2-yl]-2-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[4-(2-methylpiperazin-1-yl)-6-propylpyrimidin-2-yl]-2-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 134324541 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-N-[4-(2-methylpiperazin-1-yl)-6-propylpyrimidin-2-yl]-2-nitrobenzene-1,4-diamine |
| SMILES | CCCc1cc(N2CCNCC2C)nc(Nc2ccc(N)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C18H25N7O2/c1-3-4-13-10-17(24-8-7-20-11-12(24)2)23-18(21-13)22-14-5-6-15(19)16(9-14)25(26)27/h5-6,9-10,12,20H,3-4,7-8,11,19H2,1-2H3,(H,21,22,23) |
| InChIKey | KRGKPRWJWXIGKO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|