C18H23F3N6 — CID 121332303
4-N-[4-[(3S)-3-aminopyrrolidin-1-yl]-6-propylpyrimidin-2-yl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 121332303) has the molecular formula C18H23F3N6 and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-N-[4-[(3S)-3-aminopyrrolidin-1-yl]-6-propylpyrimidin-2-yl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-[4-[(3S)-3-aminopyrrolidin-1-yl]-6-propylpyrimidin-2-yl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 121332303 |
| Molecular Formula | C18H23F3N6 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 4-N-[4-[(3S)-3-aminopyrrolidin-1-yl]-6-propylpyrimidin-2-yl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CCCc1cc(N2CC[C@H](N)C2)nc(Nc2ccc(N)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H23F3N6/c1-2-3-12-9-16(27-7-6-11(22)10-27)26-17(24-12)25-13-4-5-15(23)14(8-13)18(19,20)21/h4-5,8-9,11H,2-3,6-7,10,22-23H2,1H3,(H,24,25,26)/t11-/m0/s1 |
| InChIKey | PGIKHZTZEUICDR-NSHDSACASA-N |
| XLogP | 3.31 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|