C22H27N7O — CID 118977179
N-[1-[2-(3-amino-5-cyanoanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]piperidin-3-yl]acetamide (PubChem CID 118977179) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is N-[1-[2-(3-amino-5-cyanoanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]piperidin-3-yl]acetamide.
| Compound Name | N-[1-[2-(3-amino-5-cyanoanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 118977179 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | N-[1-[2-(3-amino-5-cyanoanilino)-5,6,7,8-tetrahydroquinazolin-4-yl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(c2nc(Nc3cc(N)cc(C#N)c3)nc3c2CCCC3)C1 |
| InChI | InChI=1S/C22H27N7O/c1-14(30)25-17-5-4-8-29(13-17)21-19-6-2-3-7-20(19)27-22(28-21)26-18-10-15(12-23)9-16(24)11-18/h9-11,17H,2-8,13,24H2,1H3,(H,25,30)(H,26,27,28) |
| InChIKey | IPRBQRULWCDWSX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|