C23H26ClN7O — CID 118977092
N-[1-[2-(3-amino-5-cyanoanilino)-8-methylquinazolin-4-yl]piperidin-3-yl]acetamide;hydrochloride (PubChem CID 118977092) has the molecular formula C23H26ClN7O and a molecular weight of 451.96 g/mol. Its IUPAC name is N-[1-[2-(3-amino-5-cyanoanilino)-8-methylquinazolin-4-yl]piperidin-3-yl]acetamide;hydrochloride.
| Compound Name | N-[1-[2-(3-amino-5-cyanoanilino)-8-methylquinazolin-4-yl]piperidin-3-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 118977092 |
| Molecular Formula | C23H26ClN7O |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[1-[2-(3-amino-5-cyanoanilino)-8-methylquinazolin-4-yl]piperidin-3-yl]acetamide;hydrochloride |
| SMILES | CC(=O)NC1CCCN(c2nc(Nc3cc(N)cc(C#N)c3)nc3c(C)cccc23)C1.Cl |
| InChI | InChI=1S/C23H25N7O.ClH/c1-14-5-3-7-20-21(14)28-23(27-19-10-16(12-24)9-17(25)11-19)29-22(20)30-8-4-6-18(13-30)26-15(2)31;/h3,5,7,9-11,18H,4,6,8,13,25H2,1-2H3,(H,26,31)(H,27,28,29);1H |
| InChIKey | CCDDOISQRSCYCR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|