C22H25N7 — CID 118977191
3-amino-5-[[4-[3-(propylamino)pyrrolidin-1-yl]quinazolin-2-yl]amino]benzonitrile (PubChem CID 118977191) has the molecular formula C22H25N7 and a molecular weight of 387.49 g/mol. Its IUPAC name is 3-amino-5-[[4-[3-(propylamino)pyrrolidin-1-yl]quinazolin-2-yl]amino]benzonitrile.
| Compound Name | 3-amino-5-[[4-[3-(propylamino)pyrrolidin-1-yl]quinazolin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 118977191 |
| Molecular Formula | C22H25N7 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-amino-5-[[4-[3-(propylamino)pyrrolidin-1-yl]quinazolin-2-yl]amino]benzonitrile |
| SMILES | CCCNC1CCN(c2nc(Nc3cc(N)cc(C#N)c3)nc3ccccc23)C1 |
| InChI | InChI=1S/C22H25N7/c1-2-8-25-17-7-9-29(14-17)21-19-5-3-4-6-20(19)27-22(28-21)26-18-11-15(13-23)10-16(24)12-18/h3-6,10-12,17,25H,2,7-9,14,24H2,1H3,(H,26,27,28) |
| InChIKey | GTASRJMOQDEMQN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|