C22H25N7O — CID 172778086
2-amino-5-[[4-[(3S)-3-(ethylamino)pyrrolidin-1-yl]-8-methoxyquinazolin-2-yl]amino]benzonitrile (PubChem CID 172778086) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-amino-5-[[4-[(3S)-3-(ethylamino)pyrrolidin-1-yl]-8-methoxyquinazolin-2-yl]amino]benzonitrile.
| Compound Name | 2-amino-5-[[4-[(3S)-3-(ethylamino)pyrrolidin-1-yl]-8-methoxyquinazolin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 172778086 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-amino-5-[[4-[(3S)-3-(ethylamino)pyrrolidin-1-yl]-8-methoxyquinazolin-2-yl]amino]benzonitrile |
| SMILES | CCN[C@H]1CCN(c2nc(Nc3ccc(N)c(C#N)c3)nc3c(OC)cccc23)C1 |
| InChI | InChI=1S/C22H25N7O/c1-3-25-16-9-10-29(13-16)21-17-5-4-6-19(30-2)20(17)27-22(28-21)26-15-7-8-18(24)14(11-15)12-23/h4-8,11,16,25H,3,9-10,13,24H2,1-2H3,(H,26,27,28)/t16-/m0/s1 |
| InChIKey | NWLLJHHJPSRWOU-INIZCTEOSA-N |
| XLogP | 3.02 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|