C23H30Cl2N8 — CID 118977143
3-amino-5-[[4-[3-(pentylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]amino]benzonitrile;dihydrochloride (PubChem CID 118977143) has the molecular formula C23H30Cl2N8 and a molecular weight of 489.46 g/mol. Its IUPAC name is 3-amino-5-[[4-[3-(pentylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]amino]benzonitrile;dihydrochloride.
| Compound Name | 3-amino-5-[[4-[3-(pentylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]amino]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 118977143 |
| Molecular Formula | C23H30Cl2N8 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 3-amino-5-[[4-[3-(pentylamino)pyrrolidin-1-yl]pyrido[3,2-d]pyrimidin-2-yl]amino]benzonitrile;dihydrochloride |
| SMILES | CCCCCNC1CCN(c2nc(Nc3cc(N)cc(C#N)c3)nc3cccnc23)C1.Cl.Cl |
| InChI | InChI=1S/C23H28N8.2ClH/c1-2-3-4-8-26-18-7-10-31(15-18)22-21-20(6-5-9-27-21)29-23(30-22)28-19-12-16(14-24)11-17(25)13-19;;/h5-6,9,11-13,18,26H,2-4,7-8,10,15,25H2,1H3,(H,28,29,30);2*1H |
| InChIKey | WMHUPKOTJGIRIL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|