C21H22F3N5 — CID 141430934
3-N-(8-methyl-4-piperidin-1-ylquinazolin-2-yl)-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 141430934) has the molecular formula C21H22F3N5 and a molecular weight of 401.44 g/mol. Its IUPAC name is 3-N-(8-methyl-4-piperidin-1-ylquinazolin-2-yl)-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N-(8-methyl-4-piperidin-1-ylquinazolin-2-yl)-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 141430934 |
| Molecular Formula | C21H22F3N5 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-N-(8-methyl-4-piperidin-1-ylquinazolin-2-yl)-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | Cc1cccc2c(N3CCCCC3)nc(Nc3cc(N)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C21H22F3N5/c1-13-6-5-7-17-18(13)27-20(28-19(17)29-8-3-2-4-9-29)26-16-11-14(21(22,23)24)10-15(25)12-16/h5-7,10-12H,2-4,8-9,25H2,1H3,(H,26,27,28) |
| InChIKey | GYEQLXONULHDGU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|