C17H19N5O3S — CID 167090124
4-[[5-cyano-4-(cyclopentylmethoxy)pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 167090124) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is 4-[[5-cyano-4-(cyclopentylmethoxy)pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-cyano-4-(cyclopentylmethoxy)pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 167090124 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[[5-cyano-4-(cyclopentylmethoxy)pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | N#Cc1cnc(Nc2ccc(S(N)(=O)=O)cc2)nc1OCC1CCCC1 |
| InChI | InChI=1S/C17H19N5O3S/c18-9-13-10-20-17(22-16(13)25-11-12-3-1-2-4-12)21-14-5-7-15(8-6-14)26(19,23)24/h5-8,10,12H,1-4,11H2,(H2,19,23,24)(H,20,21,22) |
| InChIKey | KDYMFYUQBRLCPF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |