C16H17Cl2F3N4O — CID 21080579
5-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]pentan-1-ol (PubChem CID 21080579) has the molecular formula C16H17Cl2F3N4O and a molecular weight of 409.24 g/mol. Its IUPAC name is 5-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]pentan-1-ol.
| Compound Name | 5-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 21080579 |
| Molecular Formula | C16H17Cl2F3N4O |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 5-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]pentan-1-ol |
| SMILES | OCCCCCNc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C16H17Cl2F3N4O/c17-12-5-4-10(8-13(12)18)24-15-23-9-11(16(19,20)21)14(25-15)22-6-2-1-3-7-26/h4-5,8-9,26H,1-3,6-7H2,(H2,22,23,24,25) |
| InChIKey | XFRQFCWILKCMEW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|