C19H22Cl2F3N5O2 — CID 21080526
tert-butyl N-[3-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]carbamate (PubChem CID 21080526) has the molecular formula C19H22Cl2F3N5O2 and a molecular weight of 480.32 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 21080526 |
| Molecular Formula | C19H22Cl2F3N5O2 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | tert-butyl N-[3-[[2-(3,4-dichloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C19H22Cl2F3N5O2/c1-18(2,3)31-17(30)26-8-4-7-25-15-12(19(22,23)24)10-27-16(29-15)28-11-5-6-13(20)14(21)9-11/h5-6,9-10H,4,7-8H2,1-3H3,(H,26,30)(H2,25,27,28,29) |
| InChIKey | XPLMZWNJPCQRHC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|