C16H18BN7O2S — CID 89198507
CID 89198507 (PubChem CID 89198507) has the molecular formula C16H18BN7O2S and a molecular weight of 383.25 g/mol.
| Compound Name | CID 89198507 |
|---|---|
| PubChem CID | 89198507 |
| Molecular Formula | C16H18BN7O2S |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cccc(NS(C)(=O)=O)c2)nc1NCCc1cnc[nH]1 |
| InChI | InChI=1S/C16H18BN7O2S/c1-27(25,26)24-12-4-2-3-11(7-12)22-16-20-9-14(17)15(23-16)19-6-5-13-8-18-10-21-13/h2-4,7-10,24H,5-6H2,1H3,(H,18,21)(H2,19,20,22,23) |
| InChIKey | AVKGPSOEOHWEBX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|