C17H18BN7O2 — CID 89198417
CID 89198417 (PubChem CID 89198417) has the molecular formula C17H18BN7O2 and a molecular weight of 363.19 g/mol.
| Compound Name | CID 89198417 |
|---|---|
| PubChem CID | 89198417 |
| Molecular Formula | C17H18BN7O2 |
| Molecular Weight | 363.19 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cc(N)cc(C(=O)OC)c2)nc1NCCc1cnc[nH]1 |
| InChI | InChI=1S/C17H18BN7O2/c1-27-16(26)10-4-11(19)6-13(5-10)24-17-22-8-14(18)15(25-17)21-3-2-12-7-20-9-23-12/h4-9H,2-3,19H2,1H3,(H,20,23)(H2,21,22,24,25) |
| InChIKey | DPEYAFKSDYZYBW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|