C17H18BrN7O2 — CID 68820359
methyl 3-amino-5-[[5-bromo-4-(2-imidazol-1-ylethylamino)pyrimidin-2-yl]amino]benzoate (PubChem CID 68820359) has the molecular formula C17H18BrN7O2 and a molecular weight of 432.28 g/mol. Its IUPAC name is methyl 3-amino-5-[[5-bromo-4-(2-imidazol-1-ylethylamino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 3-amino-5-[[5-bromo-4-(2-imidazol-1-ylethylamino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 68820359 |
| Molecular Formula | C17H18BrN7O2 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | methyl 3-amino-5-[[5-bromo-4-(2-imidazol-1-ylethylamino)pyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1cc(N)cc(Nc2ncc(Br)c(NCCn3ccnc3)n2)c1 |
| InChI | InChI=1S/C17H18BrN7O2/c1-27-16(26)11-6-12(19)8-13(7-11)23-17-22-9-14(18)15(24-17)21-3-5-25-4-2-20-10-25/h2,4,6-10H,3,5,19H2,1H3,(H2,21,22,23,24) |
| InChIKey | KGJAFGRMOJXWAF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|