C15H16BN7 — CID 89198453
CID 89198453 (PubChem CID 89198453) has the molecular formula C15H16BN7 and a molecular weight of 305.15 g/mol.
| Compound Name | CID 89198453 |
|---|---|
| PubChem CID | 89198453 |
| Molecular Formula | C15H16BN7 |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cccc(N)c2)nc1NCCc1cnc[nH]1 |
| InChI | InChI=1S/C15H16BN7/c16-13-8-20-15(22-11-3-1-2-10(17)6-11)23-14(13)19-5-4-12-7-18-9-21-12/h1-3,6-9H,4-5,17H2,(H,18,21)(H2,19,20,22,23) |
| InChIKey | DLOAGSPQLLIPDX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|