C10H12ClN5 — CID 115474252
6-chloro-2-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-2,3-diamine (PubChem CID 115474252) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 6-chloro-2-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115474252 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-chloro-2-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1NCCc1cnc[nH]1 |
| InChI | InChI=1S/C10H12ClN5/c11-9-2-1-8(12)10(16-9)14-4-3-7-5-13-6-15-7/h1-2,5-6H,3-4,12H2,(H,13,15)(H,14,16) |
| InChIKey | KJOOBQLUCXGPQT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|