C19H21ClFN5O2 — CID 142829179
1-[2-amino-5-[[5-chloro-2-fluoro-6-[2-(1H-imidazol-5-yl)ethylamino]-3-methyl-4-pyridinyl]oxy]phenyl]ethanol (PubChem CID 142829179) has the molecular formula C19H21ClFN5O2 and a molecular weight of 405.86 g/mol. Its IUPAC name is 1-[2-amino-5-[[5-chloro-2-fluoro-6-[2-(1H-imidazol-5-yl)ethylamino]-3-methyl-4-pyridinyl]oxy]phenyl]ethanol.
| Compound Name | 1-[2-amino-5-[[5-chloro-2-fluoro-6-[2-(1H-imidazol-5-yl)ethylamino]-3-methyl-4-pyridinyl]oxy]phenyl]ethanol |
|---|---|
| PubChem CID | 142829179 |
| Molecular Formula | C19H21ClFN5O2 |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[2-amino-5-[[5-chloro-2-fluoro-6-[2-(1H-imidazol-5-yl)ethylamino]-3-methyl-4-pyridinyl]oxy]phenyl]ethanol |
| SMILES | Cc1c(F)nc(NCCc2cnc[nH]2)c(Cl)c1Oc1ccc(N)c(C(C)O)c1 |
| InChI | InChI=1S/C19H21ClFN5O2/c1-10-17(28-13-3-4-15(22)14(7-13)11(2)27)16(20)19(26-18(10)21)24-6-5-12-8-23-9-25-12/h3-4,7-9,11,27H,5-6,22H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ICLUGTPYGATSHQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|