C12H16N4 — CID 65231042
1-N-[2-(1H-imidazol-5-yl)ethyl]-4-methylbenzene-1,2-diamine (PubChem CID 65231042) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 1-N-[2-(1H-imidazol-5-yl)ethyl]-4-methylbenzene-1,2-diamine.
| Compound Name | 1-N-[2-(1H-imidazol-5-yl)ethyl]-4-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 65231042 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-N-[2-(1H-imidazol-5-yl)ethyl]-4-methylbenzene-1,2-diamine |
| SMILES | Cc1ccc(NCCc2cnc[nH]2)c(N)c1 |
| InChI | InChI=1S/C12H16N4/c1-9-2-3-12(11(13)6-9)15-5-4-10-7-14-8-16-10/h2-3,6-8,15H,4-5,13H2,1H3,(H,14,16) |
| InChIKey | AVGKNKPIJMOQQS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|