C18H25N9 — CID 171061588
4-N-[2-(4-aminophenyl)ethyl]-6-N-ethyl-2-N-[2-(1H-imidazol-5-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 171061588) has the molecular formula C18H25N9 and a molecular weight of 367.46 g/mol. Its IUPAC name is 4-N-[2-(4-aminophenyl)ethyl]-6-N-ethyl-2-N-[2-(1H-imidazol-5-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[2-(4-aminophenyl)ethyl]-6-N-ethyl-2-N-[2-(1H-imidazol-5-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 171061588 |
| Molecular Formula | C18H25N9 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 4-N-[2-(4-aminophenyl)ethyl]-6-N-ethyl-2-N-[2-(1H-imidazol-5-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCCc2ccc(N)cc2)nc(NCCc2cnc[nH]2)n1 |
| InChI | InChI=1S/C18H25N9/c1-2-21-16-25-17(22-9-7-13-3-5-14(19)6-4-13)27-18(26-16)23-10-8-15-11-20-12-24-15/h3-6,11-12H,2,7-10,19H2,1H3,(H,20,24)(H3,21,22,23,25,26,27) |
| InChIKey | MMEGPGDWLGYXRY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|