C15H21N3 — CID 55109450
N-(1H-imidazol-5-ylmethyl)-4-pentylaniline (PubChem CID 55109450) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-4-pentylaniline.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-4-pentylaniline |
|---|---|
| PubChem CID | 55109450 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-4-pentylaniline |
| SMILES | CCCCCc1ccc(NCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C15H21N3/c1-2-3-4-5-13-6-8-14(9-7-13)17-11-15-10-16-12-18-15/h6-10,12,17H,2-5,11H2,1H3,(H,16,18) |
| InChIKey | KPUDJWDULADLAG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|