C11H14N4O2S — CID 62761582
N-[4-(1H-imidazol-5-ylmethylamino)phenyl]methanesulfonamide (PubChem CID 62761582) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is N-[4-(1H-imidazol-5-ylmethylamino)phenyl]methanesulfonamide.
| Compound Name | N-[4-(1H-imidazol-5-ylmethylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 62761582 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-[4-(1H-imidazol-5-ylmethylamino)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(NCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C11H14N4O2S/c1-18(16,17)15-10-4-2-9(3-5-10)13-7-11-6-12-8-14-11/h2-6,8,13,15H,7H2,1H3,(H,12,14) |
| InChIKey | NYAYCAQLHHMSIT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |