C13H24N2O2Si — CID 54377265
1-N-[3-[dimethoxy(methyl)silyl]propyl]-4-methylbenzene-1,2-diamine (PubChem CID 54377265) has the molecular formula C13H24N2O2Si and a molecular weight of 268.43 g/mol. Its IUPAC name is 1-N-[3-[dimethoxy(methyl)silyl]propyl]-4-methylbenzene-1,2-diamine.
| Compound Name | 1-N-[3-[dimethoxy(methyl)silyl]propyl]-4-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 54377265 |
| Molecular Formula | C13H24N2O2Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-N-[3-[dimethoxy(methyl)silyl]propyl]-4-methylbenzene-1,2-diamine |
| SMILES | CO[Si](C)(CCCNc1ccc(C)cc1N)OC |
| InChI | InChI=1S/C13H24N2O2Si/c1-11-6-7-13(12(14)10-11)15-8-5-9-18(4,16-2)17-3/h6-7,10,15H,5,8-9,14H2,1-4H3 |
| InChIKey | UXKGEZINULMNEH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|