C11H13N3O — CID 106414484
4-methyl-1-N-(1,2-oxazol-5-ylmethyl)benzene-1,2-diamine (PubChem CID 106414484) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-methyl-1-N-(1,2-oxazol-5-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-methyl-1-N-(1,2-oxazol-5-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106414484 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-methyl-1-N-(1,2-oxazol-5-ylmethyl)benzene-1,2-diamine |
| SMILES | Cc1ccc(NCc2ccno2)c(N)c1 |
| InChI | InChI=1S/C11H13N3O/c1-8-2-3-11(10(12)6-8)13-7-9-4-5-14-15-9/h2-6,13H,7,12H2,1H3 |
| InChIKey | HDRAKKOGXYEKEP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|