C11H14N4O3S — CID 106414398
3-amino-N-methyl-4-(1,2-oxazol-5-ylmethylamino)benzenesulfonamide (PubChem CID 106414398) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-amino-N-methyl-4-(1,2-oxazol-5-ylmethylamino)benzenesulfonamide.
| Compound Name | 3-amino-N-methyl-4-(1,2-oxazol-5-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 106414398 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-amino-N-methyl-4-(1,2-oxazol-5-ylmethylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2ccno2)c(N)c1 |
| InChI | InChI=1S/C11H14N4O3S/c1-13-19(16,17)9-2-3-11(10(12)6-9)14-7-8-4-5-15-18-8/h2-6,13-14H,7,12H2,1H3 |
| InChIKey | BARAPKQLQZBRAM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|