C12H21N3O3S — CID 115358102
3-amino-4-[(3-hydroxy-2,2-dimethylpropyl)amino]-N-methylbenzenesulfonamide (PubChem CID 115358102) has the molecular formula C12H21N3O3S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-amino-4-[(3-hydroxy-2,2-dimethylpropyl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 3-amino-4-[(3-hydroxy-2,2-dimethylpropyl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115358102 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-amino-4-[(3-hydroxy-2,2-dimethylpropyl)amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCC(C)(C)CO)c(N)c1 |
| InChI | InChI=1S/C12H21N3O3S/c1-12(2,8-16)7-15-11-5-4-9(6-10(11)13)19(17,18)14-3/h4-6,14-16H,7-8,13H2,1-3H3 |
| InChIKey | YECCRCHSSGVYIN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|