C11H18N2O4S — CID 66170096
3-(2-amino-4-methylsulfonylanilino)-2-methylpropane-1,2-diol (PubChem CID 66170096) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-(2-amino-4-methylsulfonylanilino)-2-methylpropane-1,2-diol.
| Compound Name | 3-(2-amino-4-methylsulfonylanilino)-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 66170096 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-(2-amino-4-methylsulfonylanilino)-2-methylpropane-1,2-diol |
| SMILES | CC(O)(CO)CNc1ccc(S(C)(=O)=O)cc1N |
| InChI | InChI=1S/C11H18N2O4S/c1-11(15,7-14)6-13-10-4-3-8(5-9(10)12)18(2,16)17/h3-5,13-15H,6-7,12H2,1-2H3 |
| InChIKey | ZHSGZKDWCSBOLI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|