C11H20N4O4S2 — CID 63861562
3-amino-4-[[2-(methanesulfonamido)-2-methylpropyl]amino]benzenesulfonamide (PubChem CID 63861562) has the molecular formula C11H20N4O4S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-amino-4-[[2-(methanesulfonamido)-2-methylpropyl]amino]benzenesulfonamide.
| Compound Name | 3-amino-4-[[2-(methanesulfonamido)-2-methylpropyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 63861562 |
| Molecular Formula | C11H20N4O4S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-amino-4-[[2-(methanesulfonamido)-2-methylpropyl]amino]benzenesulfonamide |
| SMILES | CC(C)(CNc1ccc(S(N)(=O)=O)cc1N)NS(C)(=O)=O |
| InChI | InChI=1S/C11H20N4O4S2/c1-11(2,15-20(3,16)17)7-14-10-5-4-8(6-9(10)12)21(13,18)19/h4-6,14-15H,7,12H2,1-3H3,(H2,13,18,19) |
| InChIKey | OCBOUXFMCDCHNC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|