C12H20N2O4S2 — CID 78954539
1-N-[2,4-bis(methylsulfonyl)phenyl]-2-methylpropane-1,2-diamine (PubChem CID 78954539) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-N-[2,4-bis(methylsulfonyl)phenyl]-2-methylpropane-1,2-diamine.
| Compound Name | 1-N-[2,4-bis(methylsulfonyl)phenyl]-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 78954539 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-N-[2,4-bis(methylsulfonyl)phenyl]-2-methylpropane-1,2-diamine |
| SMILES | CC(C)(N)CNc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O4S2/c1-12(2,13)8-14-10-6-5-9(19(3,15)16)7-11(10)20(4,17)18/h5-7,14H,8,13H2,1-4H3 |
| InChIKey | IBFHPDXRYYRUIN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |