C11H17N3O4S3 — CID 43455086
(4-methylsulfonyl-2-thiomorpholin-4-ylsulfonylphenyl)hydrazine (PubChem CID 43455086) has the molecular formula C11H17N3O4S3 and a molecular weight of 351.48 g/mol. Its IUPAC name is (4-methylsulfonyl-2-thiomorpholin-4-ylsulfonylphenyl)hydrazine.
| Compound Name | (4-methylsulfonyl-2-thiomorpholin-4-ylsulfonylphenyl)hydrazine |
|---|---|
| PubChem CID | 43455086 |
| Molecular Formula | C11H17N3O4S3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | (4-methylsulfonyl-2-thiomorpholin-4-ylsulfonylphenyl)hydrazine |
| SMILES | CS(=O)(=O)c1ccc(NN)c(S(=O)(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C11H17N3O4S3/c1-20(15,16)9-2-3-10(13-12)11(8-9)21(17,18)14-4-6-19-7-5-14/h2-3,8,13H,4-7,12H2,1H3 |
| InChIKey | AUTVFJNAFQDMQX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|