C11H19N3O5S2 — CID 102699204
2-hydrazinyl-N-(2-methoxypropyl)-5-methylsulfonylbenzenesulfonamide (PubChem CID 102699204) has the molecular formula C11H19N3O5S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2-methoxypropyl)-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-hydrazinyl-N-(2-methoxypropyl)-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 102699204 |
| Molecular Formula | C11H19N3O5S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-hydrazinyl-N-(2-methoxypropyl)-5-methylsulfonylbenzenesulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1NN |
| InChI | InChI=1S/C11H19N3O5S2/c1-8(19-2)7-13-21(17,18)11-6-9(20(3,15)16)4-5-10(11)14-12/h4-6,8,13-14H,7,12H2,1-3H3 |
| InChIKey | FWILDDWUWHGFIU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|