C11H16N6 — CID 56711259
6-(aminomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine (PubChem CID 56711259) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 6-(aminomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-(aminomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 56711259 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 6-(aminomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(CN)cc(NCCc2cnc[nH]2)n1 |
| InChI | InChI=1S/C11H16N6/c1-8-16-10(5-12)4-11(17-8)14-3-2-9-6-13-7-15-9/h4,6-7H,2-3,5,12H2,1H3,(H,13,15)(H,14,16,17) |
| InChIKey | ISXFOOORKNOOJF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |