C10H12ClN5S — CID 106195075
6-chloro-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylsulfanylpyrimidin-4-amine (PubChem CID 106195075) has the molecular formula C10H12ClN5S and a molecular weight of 269.76 g/mol. Its IUPAC name is 6-chloro-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106195075 |
| Molecular Formula | C10H12ClN5S |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 6-chloro-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NCCc2cnc[nH]2)n1 |
| InChI | InChI=1S/C10H12ClN5S/c1-17-10-15-8(11)4-9(16-10)13-3-2-7-5-12-6-14-7/h4-6H,2-3H2,1H3,(H,12,14)(H,13,15,16) |
| InChIKey | ICTQQVZXUFSBOP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |