C18H23Cl2FN2O3 — CID 162138539
4-[[3,5-dichloro-2-fluoro-6-[[(2R)-1-hydroxypropan-2-yl]amino]-4-pyridinyl]oxy]-2-propan-2-ylphenol;methane (PubChem CID 162138539) has the molecular formula C18H23Cl2FN2O3 and a molecular weight of 405.30 g/mol. Its IUPAC name is 4-[[3,5-dichloro-2-fluoro-6-[[(2R)-1-hydroxypropan-2-yl]amino]-4-pyridinyl]oxy]-2-propan-2-ylphenol;methane.
| Compound Name | 4-[[3,5-dichloro-2-fluoro-6-[[(2R)-1-hydroxypropan-2-yl]amino]-4-pyridinyl]oxy]-2-propan-2-ylphenol;methane |
|---|---|
| PubChem CID | 162138539 |
| Molecular Formula | C18H23Cl2FN2O3 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-[[3,5-dichloro-2-fluoro-6-[[(2R)-1-hydroxypropan-2-yl]amino]-4-pyridinyl]oxy]-2-propan-2-ylphenol;methane |
| SMILES | C.CC(C)c1cc(Oc2c(Cl)c(F)nc(N[C@H](C)CO)c2Cl)ccc1O |
| InChI | InChI=1S/C17H19Cl2FN2O3.CH4/c1-8(2)11-6-10(4-5-12(11)24)25-15-13(18)16(20)22-17(14(15)19)21-9(3)7-23;/h4-6,8-9,23-24H,7H2,1-3H3,(H,21,22);1H4/t9-;/m1./s1 |
| InChIKey | ZJPSVLXRUJVNBY-SBSPUUFOSA-N |
| XLogP | 5.58 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|