C17H20Cl2FN2O4P — CID 143055701
4-[[3,5-dichloro-2-(dimethoxyphosphanylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol (PubChem CID 143055701) has the molecular formula C17H20Cl2FN2O4P and a molecular weight of 437.24 g/mol. Its IUPAC name is 4-[[3,5-dichloro-2-(dimethoxyphosphanylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol.
| Compound Name | 4-[[3,5-dichloro-2-(dimethoxyphosphanylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 143055701 |
| Molecular Formula | C17H20Cl2FN2O4P |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 4-[[3,5-dichloro-2-(dimethoxyphosphanylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol |
| SMILES | COP(CNc1nc(F)c(Cl)c(Oc2ccc(O)c(C(C)C)c2)c1Cl)OC |
| InChI | InChI=1S/C17H20Cl2FN2O4P/c1-9(2)11-7-10(5-6-12(11)23)26-15-13(18)16(20)22-17(14(15)19)21-8-27(24-3)25-4/h5-7,9,23H,8H2,1-4H3,(H,21,22) |
| InChIKey | PCEPAYBWQVBHEH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|