C22H27N5O4 — CID 22547619
dimethyl 5-[[5-amino-6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 22547619) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is dimethyl 5-[[5-amino-6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[5-amino-6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22547619 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | dimethyl 5-[[5-amino-6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc(NCCC3=CCCCC3)c2N)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H27N5O4/c1-30-21(28)15-10-16(22(29)31-2)12-17(11-15)27-20-18(23)19(25-13-26-20)24-9-8-14-6-4-3-5-7-14/h6,10-13H,3-5,7-9,23H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | MXCRUZYZAAPZSZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|