C19H22F3N5 — CID 19143608
6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[3-(trifluoromethyl)phenyl]pyrimidine-4,5,6-triamine (PubChem CID 19143608) has the molecular formula C19H22F3N5 and a molecular weight of 377.41 g/mol. Its IUPAC name is 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[3-(trifluoromethyl)phenyl]pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[3-(trifluoromethyl)phenyl]pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143608 |
| Molecular Formula | C19H22F3N5 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[3-(trifluoromethyl)phenyl]pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCC2=CCCCC2)ncnc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H22F3N5/c20-19(21,22)14-7-4-8-15(11-14)27-18-16(23)17(25-12-26-18)24-10-9-13-5-2-1-3-6-13/h4-5,7-8,11-12H,1-3,6,9-10,23H2,(H2,24,25,26,27) |
| InChIKey | KUOTZIPFLPEMDH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|