C22H30N6 — CID 19138548
4-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-phenylpiperazin-1-yl)pyrimidine-4,5-diamine (PubChem CID 19138548) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-phenylpiperazin-1-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-phenylpiperazin-1-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19138548 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-phenylpiperazin-1-yl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(NCCC2=CCCCC2)ncnc1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N6/c23-20-21(24-12-11-18-7-3-1-4-8-18)25-17-26-22(20)28-15-13-27(14-16-28)19-9-5-2-6-10-19/h2,5-7,9-10,17H,1,3-4,8,11-16,23H2,(H,24,25,26) |
| InChIKey | QCXHEGFCYNXWAI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|