C18H21N7 — CID 19143714
6-(benzotriazol-1-yl)-4-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-4,5-diamine (PubChem CID 19143714) has the molecular formula C18H21N7 and a molecular weight of 335.42 g/mol. Its IUPAC name is 6-(benzotriazol-1-yl)-4-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-4,5-diamine.
| Compound Name | 6-(benzotriazol-1-yl)-4-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19143714 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 6-(benzotriazol-1-yl)-4-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-4,5-diamine |
| SMILES | Nc1c(NCCC2=CCCCC2)ncnc1-n1nnc2ccccc21 |
| InChI | InChI=1S/C18H21N7/c19-16-17(20-11-10-13-6-2-1-3-7-13)21-12-22-18(16)25-15-9-5-4-8-14(15)23-24-25/h4-6,8-9,12H,1-3,7,10-11,19H2,(H,20,21,22) |
| InChIKey | ZPTIHPSYGIFOLN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|